Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-1H-Purin-6-Ylsulfuric Diamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C5H6N6O2S |
| Molecular Weight | 214.21 |
| CAS Registry Number | 101910-08-1 |
| SMILES | c1[nH]c2c(n1)ncnc2NS(=O)(=O)N |
| InChI | 1S/C5H6N6O2S/c6-14(12,13)11-5-3-4(8-1-7-3)9-2-10-5/h1-2H,(H2,6,12,13)(H2,7,8,9,10,11) |
| InChIKey | ZOPZTNPEGYFXIT-UHFFFAOYSA-N |
| Density | 1.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.064°C at 760 mmHg (Cal.) |
| Flash point | 348.156°C (Cal.) |
| Refractive index | 1.824 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-1H-Purin-6-Ylsulfuric Diamide |