Online Database of Chemicals from Around the World
|
CAS#: 13174-97-5 Product: 4-Methyl-alpha-Carboline No suppilers available for the product. |
| Name | 4-Methyl-alpha-Carboline |
|---|---|
| Synonyms | 1H-Pyrido(2,3-B)Indole, 4-Methyl-; 4-Methyl-Alpha-Carboline |
| Molecular Structure |  |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 13174-97-5 |
| SMILES | C1=CC=CC3=C1C2=C(C=CN=C2[NH]3)C |
| InChI | 1S/C12H10N2/c1-8-6-7-13-12-11(8)9-4-2-3-5-10(9)14-12/h2-7H,1H3,(H,13,14) |
| InChIKey | MIOULEPPXLEANT-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.171°C at 760 mmHg (Cal.) |
| Flash point | 176.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-alpha-Carboline |