Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Trichloro(Chloromethyl)Benzene |
|---|---|
| Synonyms | Caswell No. 873A; Epa Pesticide Chemical Code 017304 |
| Molecular Structure |  |
| Molecular Formula | C7H4Cl4 |
| Molecular Weight | 229.92 |
| CAS Registry Number | 1344-32-7 |
| EINECS | 215-692-1 |
| SMILES | C1=C(C=C(C(=C1Cl)CCl)Cl)Cl |
| InChI | 1S/C7H4Cl4/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
| InChIKey | NJQRKFOZZUIMGW-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.709°C at 760 mmHg (Cal.) |
| Flash point | 127.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(Chloromethyl)Benzene |