Online Database of Chemicals from Around the World
|
CAS#: 1575-95-7 Product: N-Acetyl-Benzamide No suppilers available for the product. |
| Name | N-Acetyl-Benzamide |
|---|---|
| Synonyms | N-Ethanoylbenzamide; Nsc85835; Nciopen2_001060 |
| Molecular Structure |  |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 1575-95-7 |
| SMILES | C1=C(C(NC(C)=O)=O)C=CC=C1 |
| InChI | 1S/C9H9NO2/c1-7(11)10-9(12)8-5-3-2-4-6-8/h2-6H,1H3,(H,10,11,12) |
| InChIKey | KGGRQKDGRGUWAT-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.619°C at 760 mmHg (Cal.) |
| Flash point | 142.618°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-Benzamide |