Online Database of Chemicals from Around the World
|
CAS#: 17175-16-5 Product: Methyl-4-Nitrophenylcarbonate No suppilers available for the product. |
| Name | Methyl-4-Nitrophenylcarbonate |
|---|---|
| Synonyms | Carbonic Acid Methyl (4-Nitrophenyl) Ester; Carbonic Acid, Methyl P-Nitrophenyl Ester; Carbonic Acid, Methyl 4-Nitrophenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.15 |
| CAS Registry Number | 17175-16-5 |
| SMILES | C1=C(C=CC(=C1)OC(=O)OC)[N+]([O-])=O |
| InChI | 1S/C8H7NO5/c1-13-8(10)14-7-4-2-6(3-5-7)9(11)12/h2-5H,1H3 |
| InChIKey | BKNCSPZEGXUNTP-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.708°C at 760 mmHg (Cal.) |
| Flash point | 158.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl-4-Nitrophenylcarbonate |