Online Database of Chemicals from Around the World
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (843)-884-4911 | |||
 |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Cyclohexylphenyl)Thiourea |
|---|---|
| Synonyms | THIOUREA,N-(4-CYCLOHEXYLPHENYL)-; ZINC00100288 |
| Molecular Structure |  |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.36 |
| CAS Registry Number | 175205-17-1 |
| SMILES | S=C(N)Nc1ccc(cc1)C2CCCCC2 |
| InChI | 1S/C13H18N2S/c14-13(16)15-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2,(H3,14,15,16) |
| InChIKey | NUOXMWHYKUBMNI-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.697°C at 760 mmHg (Cal.) |
| Flash point | 179.201°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Cyclohexylphenyl)Thiourea |