|
CAS#: 19262-92-1 Product: Zinc Dihydrogen Diphosphate No suppilers available for the product. |
| Name | Zinc Dihydrogen Diphosphate |
|---|---|
| Synonyms | Diphosphoric acid zinc salt (1:2); diphosphoric acid, zinc salt; Pyrophosp |
| Molecular Structure | ![]() |
| Molecular Formula | H2O7P2Zn |
| Molecular Weight | 241.37 |
| CAS Registry Number | 19262-92-1 |
| EINECS | 242-927-5 |
| SMILES | [Zn+2].[O-]P([O-])(=O)OP(=O)(O)O |
| InChI | 1S/H4O7P2.Zn/c1-8(2,3)7-9(4,5)6;/h(H2,1,2,3)(H2,4,5,6);/q;+2/p-2 |
| InChIKey | RPRMAEUXQLFUQL-UHFFFAOYSA-L |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Zinc Dihydrogen Diphosphate |