|
CAS#: 216433-58-8 Product: 1,3,5-Trimethoxy-2-[(E)-2-Nitrovinyl]Benzene No suppilers available for the product. |
| Name | 1,3,5-Trimethoxy-2-[(E)-2-Nitrovinyl]Benzene |
|---|---|
| Synonyms | 2-((1E)-2-nitrovinyl)-1,3,5-trimethoxybenzene; 2,4,6-trimethoxy-β-nitrostyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22 |
| CAS Registry Number | 216433-58-8 |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=C/[N+](=O)[O-])OC |
| InChI | 1S/C11H13NO5/c1-15-8-6-10(16-2)9(4-5-12(13)14)11(7-8)17-3/h4-7H,1-3H3/b5-4+ |
| InChIKey | URHPFHDNYKOMAI-SNAWJCMRSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.7±40.0°C at 760 mmHg (Cal.) |
| Flash point | 186.6±29.3°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethoxy-2-[(E)-2-Nitrovinyl]Benzene |