Online Database of Chemicals from Around the World
| Enamine Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 537-3218 | |||
 |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 355-9920 | |||
|
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Ethyl N-(2-Nitrophenyl)Carbamate |
|---|---|
| Synonyms | N-(2-Nitrophenyl)Carbamic Acid Ethyl Ester; 2-Nitrophenylurethane; Carbamic Acid, (2-Nitrophenyl)-, Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 |
| CAS Registry Number | 2621-84-3 |
| SMILES | C1=CC=CC(=C1NC(OCC)=O)[N+](=O)[O-] |
| InChI | 1S/C9H10N2O4/c1-2-15-9(12)10-7-5-3-4-6-8(7)11(13)14/h3-6H,2H2,1H3,(H,10,12) |
| InChIKey | AUDONQPVYRSJNX-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.813°C at 760 mmHg (Cal.) |
| Flash point | 125.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-(2-Nitrophenyl)Carbamate |