Online Database of Chemicals from Around the World
|
CAS#: 28489-52-3 Product: 3-Methyl-2,6-Diphenylpyridine No suppilers available for the product. |
| Name | 3-Methyl-2,6-Diphenylpyridine |
|---|---|
| Synonyms | 3-Picoline, 2,6-Diphenyl-; Pyridine, 3-Methyl-2,6-Diphenyl-; 3-Methyl-2,6-Diphenylpyridine |
| Molecular Structure |  |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 |
| CAS Registry Number | 28489-52-3 |
| EINECS | 249-054-9 |
| SMILES | C1=CC(=C(N=C1C2=CC=CC=C2)C3=CC=CC=C3)C |
| InChI | 1S/C18H15N/c1-14-12-13-17(15-8-4-2-5-9-15)19-18(14)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | CZJKYAPZMSCBHB-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.587°C at 760 mmHg (Cal.) |
| Flash point | 161.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2,6-Diphenylpyridine |