|
CAS#: 2960-37-4 Product: N-(Diphenylphosphino)-P,P-diphenylphosphinous amide No suppilers available for the product. |
| Name | N-(Diphenylphosphino)-P,P-diphenylphosphinous amide |
|---|---|
| Synonyms | bis(diphenylphosphino)amine; N-(Diphenylphosphino)-p,p-diphenylphosphinous amide #; N,N-BIS(DIPHENYLPHOSPHINO)AMINE |
| Molecular Structure | ![]() |
| Molecular Formula | C24H21NP2 |
| Molecular Weight | 385.38 |
| CAS Registry Number | 2960-37-4 |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)NP(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C24H21NP2/c1-5-13-21(14-6-1)26(22-15-7-2-8-16-22)25-27(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25H |
| InChIKey | AVYXASMIUOIQII-UHFFFAOYSA-N |
| Boiling point | 515.7±33.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 265.7±25.4°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| (1) | S. Jafar Hoseini, Maryam Mohamadikish, Katayon Kamali, Frank W. Heinemann and Mehdi Rashidi. Organoplatinum complexes containing bis(diphenylphosphino)amine as ligand: uncommon case of N–H?I–Pt hydrogen bonding, Dalton Trans., 2007, 0, 1697. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(Diphenylphosphino)-P,P-diphenylphosphinous amide |