Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[(Z)-(4-Ethyl-3,5-Dimethyl-2H-Pyrrol-2-Ylidene)Methyl]Phenol |
|---|---|
| Synonyms | (Z)-4-((4 |
| Molecular Structure | ![CAS#: 524746-06-3， 4-[(Z)-(4-Ethyl-3,5-Dimethyl-2H-Pyrrol-2-Ylidene)Methyl]Phenol](/moreStructures/524746-06-3.gif) |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.30 |
| CAS Registry Number | 524746-06-3 |
| SMILES | CCC1=C(/C(=C/c2ccc(cc2)O)/N=C1C)C |
| InChI | 1S/C15H17NO/c1-4-14-10(2)15(16-11(14)3)9-12-5-7-13(17)8-6-12/h5-9,17H,4H2,1-3H3/b15-9- |
| InChIKey | HCGSNSFXQIWHPR-DHDCSXOGSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.014°C at 760 mmHg (Cal.) |
| Flash point | 229.971°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Z)-(4-Ethyl-3,5-Dimethyl-2H-Pyrrol-2-Ylidene)Methyl]Phenol |