Online Database of Chemicals from Around the World
|
CAS#: 69427-41-4 Product: 13-cis-Etretinate No suppilers available for the product. |
| Name | 13-cis-Etretinate |
|---|---|
| Synonyms | Ethyl (2Z,4E,6E,8E)-9-(4-Methoxy-2,3,6-Trimethyl-Phenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraenoate; (2Z,4E,6E,8E)-9-(4-Methoxy-2,3,6-Trimethylphenyl)-3,7-Dimethylnona-2,4,6,8-Tetraenoic Acid Ethyl Ester; (2Z,4E,6E,8E)-9-(4-Methoxy-2,3,6-Trimethyl-Phenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraenoic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 |
| CAS Registry Number | 69427-41-4 |
| SMILES | C1=C(C(=C(C(=C1C)\C=C\C(=C\C=C\C(=C/C(=O)OCC)C)C)C)C)OC |
| InChI | 1S/C23H30O3/c1-8-26-23(24)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(25-7)20(6)19(21)5/h9-15H,8H2,1-7H3/b11-9+,13-12+,16-10+,17-14- |
| InChIKey | HQMNCQVAMBCHCO-RAZVQKLASA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.437°C at 760 mmHg (Cal.) |
| Flash point | 219.418°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13-cis-Etretinate |