|
CAS#: 81402-46-2 Product: N,N-Dimethyl-Gamma-Phenyl-1-Piperidinepropanamine (Z)-2-Butenedioate (1:2) No suppilers available for the product. |
| Name | N,N-Dimethyl-Gamma-Phenyl-1-Piperidinepropanamine (Z)-2-Butenedioate (1:2) |
|---|---|
| Synonyms | But-2-Enedioic Acid; N,N-Dimethyl-3-Phenyl-3-(1-Piperidyl)Propan-1-Amine; But-2-Enedioic Acid; Dimethyl-(3-Phenyl-3-Piperidino-Propyl)Amine; But-2-Enedioic Acid; N,N-Dimethyl-3-Phenyl-3-Piperidin-1-Yl-Propan-1-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 |
| CAS Registry Number | 81402-46-2 |
| SMILES | O=C(O)\C=C\C(=O)O.O=C(O)\C=C\C(=O)O.C(C(N1CCCCC1)C2=CC=CC=C2)CN(C)C |
| InChI | 1S/C16H26N2.2C4H4O4/c1-17(2)14-11-16(15-9-5-3-6-10-15)18-12-7-4-8-13-18;2*5-3(6)1-2-4(7)8/h3,5-6,9-10,16H,4,7-8,11-14H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | KMKJJUADNUKWBN-LVEZLNDCSA-N |
| Boiling point | 337.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-Gamma-Phenyl-1-Piperidinepropanamine (Z)-2-Butenedioate (1:2) |