|
CAS#: 85391-13-5 Product: 5-Isopropyl-2-Phenylpyridine No suppilers available for the product. |
| Name | 5-Isopropyl-2-Phenylpyridine |
|---|---|
| Synonyms | 5-Isopropyl-2-Phenyl-Pyridine; 5-Isopropyl-2-Phenylpyridine; 2-Phenyl-5-Propan-2-Yl-Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 85391-13-5 |
| EINECS | 286-765-3 |
| SMILES | C1=C(C(C)C)C=CC(=N1)C2=CC=CC=C2 |
| InChI | 1S/C14H15N/c1-11(2)13-8-9-14(15-10-13)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | ZHJXMVDNGJWXGZ-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.644°C at 760 mmHg (Cal.) |
| Flash point | 130.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-2-Phenylpyridine |