Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]methanamine |
|---|---|
| Synonyms | 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]methanamin; 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]methanamine; 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]méthanamine |
| Molecular Structure | ![CAS#: 885273-48-3， 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]methanamine](/moreStructures/885273-48-3.gif) |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 885273-48-3 |
| SMILES | c1cc2c(cc1c3nc(co3)CN)OCO2 |
| InChI | 1S/C11H10N2O3/c12-4-8-5-14-11(13-8)7-1-2-9-10(3-7)16-6-15-9/h1-3,5H,4,6,12H2 |
| InChIKey | QJARZYMWPNQKON-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.8±52.0°C at 760 mmHg (Cal.) |
| Flash point | 189.6±30.7°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(1,3-Benzodioxol-5-yl)-1,3-oxazol-4-yl]methanamine |