| Pharnorcia Inc., Wuhan | China | Inquire | ||
|---|---|---|---|---|
![]() | www.pharnorcia.com.cn | |||
![]() | +86 13911254076 | |||
![]() | lhivision@163.com | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | (3-Methacryloxy-2-hydroxypropoxy)propylbis(trimethylsiloxy)methylsilan |
|---|---|
| Synonyms | [2-Hydroxy-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] 2-methylprop-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H38O6Si3 |
| Molecular Weight | 422.74 |
| CAS Registry Number | 69861-02-5 |
| EC Number | 810-701-0 |
| SMILES | CC(=C)C(=O)OCC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O |
| Solubility | 0.01061 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.446, Calc.* |
| Melting point | 113.70 °C |
| Boiling Point | 377.82 °C, 420.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 208.1±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H319 Details | ||||||||
| Safety Statements | P264+P265-P280-P305+P351+P338-P337+P317 Details | ||||||||
| Hazard Classification | |||||||||
| |||||||||
| SDS | Available | ||||||||
| Market Analysis Reports |
| List of Reports Available for (3-Methacryloxy-2-hydroxypropoxy)propylbis(trimethylsiloxy)methylsilan |